C38H40F6N6O10 — CID 90747165
(2,5-dihydroxypyrrol-1-yl) 4-[[8-[[4-(2,5-dihydroxypyrrol-1-yl)oxycarbonylphenyl]methyl]-4,11-bis(2,2,2-trifluoroacetyl)-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]benzoate (PubChem CID 90747165) has the molecular formula C38H40F6N6O10 and a molecular weight of 854.76 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[[8-[[4-(2,5-dihydroxypyrrol-1-yl)oxycarbonylphenyl]methyl]-4,11-bis(2,2,2-trifluoroacetyl)-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]benzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[[8-[[4-(2,5-dihydroxypyrrol-1-yl)oxycarbonylphenyl]methyl]-4,11-bis(2,2,2-trifluoroacetyl)-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 90747165 |
| Molecular Formula | C38H40F6N6O10 |
| Molecular Weight | 854.76 g/mol |
| Exact Mass | 854.27 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[[8-[[4-(2,5-dihydroxypyrrol-1-yl)oxycarbonylphenyl]methyl]-4,11-bis(2,2,2-trifluoroacetyl)-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]benzoate |
| SMILES | O=C(On1c(O)ccc1O)c1ccc(CN2CCCN(C(=O)C(F)(F)F)CCN(Cc3ccc(C(=O)On4c(O)ccc4O)cc3)CCCN(C(=O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C38H40F6N6O10/c39-37(40,41)35(57)47-17-1-15-45(23-25-3-7-27(8-4-25)33(55)59-49-29(51)11-12-30(49)52)19-22-48(36(58)38(42,43)44)18-2-16-46(20-21-47)24-26-5-9-28(10-6-26)34(56)60-50-31(53)13-14-32(50)54/h3-14,51-54H,1-2,15-24H2 |
| InChIKey | WNPMIABNXNNLTE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 190.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |