C18H18F3N3O5S — CID 90747246
5-[[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-1H-pyridin-2-one (PubChem CID 90747246) has the molecular formula C18H18F3N3O5S and a molecular weight of 445.42 g/mol. Its IUPAC name is 5-[[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-1H-pyridin-2-one.
| Compound Name | 5-[[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 90747246 |
| Molecular Formula | C18H18F3N3O5S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 5-[[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-1H-pyridin-2-one |
| SMILES | O=c1ccc(CONC2=CCN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)CC2)c[nH]1 |
| InChI | InChI=1S/C18H18F3N3O5S/c19-18(20,21)29-15-2-4-16(5-3-15)30(26,27)24-9-7-14(8-10-24)23-28-12-13-1-6-17(25)22-11-13/h1-7,11,23H,8-10,12H2,(H,22,25) |
| InChIKey | LXMSUPZKLOGYFZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|