About N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide
N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide (PubChem CID 90747496) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide |
| PubChem CID | 90747496 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1cc[nH]c1 |
| InChI | InChI=1S/C11H16N2O2/c14-10-4-2-1-3-9(10)13-11(15)8-5-6-12-7-8/h5-7,9-10,12,14H,1-4H2,(H,13,15)/t9-,10-/m1/s1 |
| InChIKey | SSJDLFOZAJUVCC-NXEZZACHSA-N |
| XLogP | 1.05 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide?
The IUPAC name of N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide (CID 90747496) is N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide.
What is the SMILES notation for N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide?
The canonical SMILES for N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide is O=C(N[C@@H]1CCCC[C@H]1O)c1cc[nH]c1.
What is the InChIKey of N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide?
The InChIKey is SSJDLFOZAJUVCC-NXEZZACHSA-N. The full InChI is InChI=1S/C11H16N2O2/c14-10-4-2-1-3-9(10)13-11(15)8-5-6-12-7-8/h5-7,9-10,12,14H,1-4H2,(H,13,15)/t9-,10-/m1/s1.
What are the key properties of N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide?
N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide has a molecular weight of 208.26 g/mol, XLogP of 1.05, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-hydroxycyclohexyl]-1H-pyrrole-3-carboxamide is sourced from PubChem (CID 90747496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).