C8H9F3N4O2 — CID 90747505
3-methyl-6-[methyl-(2,2,2-trifluoroethylideneamino)amino]-1H-pyrimidine-2,4-dione (PubChem CID 90747505) has the molecular formula C8H9F3N4O2 and a molecular weight of 250.18 g/mol. Its IUPAC name is 3-methyl-6-[methyl-(2,2,2-trifluoroethylideneamino)amino]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-methyl-6-[methyl-(2,2,2-trifluoroethylideneamino)amino]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90747505 |
| Molecular Formula | C8H9F3N4O2 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 3-methyl-6-[methyl-(2,2,2-trifluoroethylideneamino)amino]-1H-pyrimidine-2,4-dione |
| SMILES | CN(N=CC(F)(F)F)c1cc(=O)n(C)c(=O)[nH]1 |
| InChI | InChI=1S/C8H9F3N4O2/c1-14-6(16)3-5(13-7(14)17)15(2)12-4-8(9,10)11/h3-4H,1-2H3,(H,13,17) |
| InChIKey | SNXIXUCPNRCMAJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|