C11H11F3N2O — CID 90747922
7-amino-3-methyl-2-(2,2,2-trifluoroethyl)isoindol-1-ol (PubChem CID 90747922) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 7-amino-3-methyl-2-(2,2,2-trifluoroethyl)isoindol-1-ol.
| Compound Name | 7-amino-3-methyl-2-(2,2,2-trifluoroethyl)isoindol-1-ol |
|---|---|
| PubChem CID | 90747922 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 7-amino-3-methyl-2-(2,2,2-trifluoroethyl)isoindol-1-ol |
| SMILES | Cc1c2cccc(N)c2c(O)n1CC(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O/c1-6-7-3-2-4-8(15)9(7)10(17)16(6)5-11(12,13)14/h2-4,17H,5,15H2,1H3 |
| InChIKey | GJKDOFBEVIRIRU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|