About 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate
2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate (PubChem CID 90748027) has the molecular formula C20H22ClN3O4S
and a molecular weight of 435.93 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate.
Molecular Properties
| Compound Name | 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate |
| PubChem CID | 90748027 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCc1cn(S(=O)(=O)c2ccccc2Cl)c2cccnc12 |
| InChI | InChI=1S/C20H22ClN3O4S/c1-20(2,3)23-19(25)28-12-10-14-13-24(16-8-6-11-22-18(14)16)29(26,27)17-9-5-4-7-15(17)21/h4-9,11,13H,10,12H2,1-3H3,(H,23,25) |
| InChIKey | HQYBSHFUGOJHJS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate?
The IUPAC name of 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate (CID 90748027) is 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate.
What is the SMILES notation for 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate?
The canonical SMILES for 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate is CC(C)(C)NC(=O)OCCc1cn(S(=O)(=O)c2ccccc2Cl)c2cccnc12.
What is the InChIKey of 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate?
The InChIKey is HQYBSHFUGOJHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClN3O4S/c1-20(2,3)23-19(25)28-12-10-14-13-24(16-8-6-11-22-18(14)16)29(26,27)17-9-5-4-7-15(17)21/h4-9,11,13H,10,12H2,1-3H3,(H,23,25).
What are the key properties of 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate?
2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate has a molecular weight of 435.93 g/mol, XLogP of 3.99, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]ethyl N-tert-butylcarbamate is sourced from PubChem (CID 90748027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).