C13H15N3 — CID 90748214
1-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)benzimidazole (PubChem CID 90748214) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)benzimidazole.
| Compound Name | 1-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)benzimidazole |
|---|---|
| PubChem CID | 90748214 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)benzimidazole |
| SMILES | Cn1cnc2ccc(C3=CCNCC3)cc21 |
| InChI | InChI=1S/C13H15N3/c1-16-9-15-12-3-2-11(8-13(12)16)10-4-6-14-7-5-10/h2-4,8-9,14H,5-7H2,1H3 |
| InChIKey | NZXJCPVFTKNADF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |