C22H17ClN4O2 — CID 90748361
4-chloro-N-[[1-[4-(2-oxo-1H-pyridin-3-yl)phenyl]imidazol-4-yl]methyl]benzamide (PubChem CID 90748361) has the molecular formula C22H17ClN4O2 and a molecular weight of 404.86 g/mol. Its IUPAC name is 4-chloro-N-[[1-[4-(2-oxo-1H-pyridin-3-yl)phenyl]imidazol-4-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[1-[4-(2-oxo-1H-pyridin-3-yl)phenyl]imidazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 90748361 |
| Molecular Formula | C22H17ClN4O2 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-chloro-N-[[1-[4-(2-oxo-1H-pyridin-3-yl)phenyl]imidazol-4-yl]methyl]benzamide |
| SMILES | O=C(NCc1cn(-c2ccc(-c3ccc[nH]c3=O)cc2)cn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17ClN4O2/c23-17-7-3-16(4-8-17)21(28)25-12-18-13-27(14-26-18)19-9-5-15(6-10-19)20-2-1-11-24-22(20)29/h1-11,13-14H,12H2,(H,24,29)(H,25,28) |
| InChIKey | USWMYJIMHXAFTB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |