C16H18NO9S3+ — CID 90748446
3-(4-sulfobutyl)-1H-benzo[e]indol-3-ium-6,8-disulfonic acid (PubChem CID 90748446) has the molecular formula C16H18NO9S3+ and a molecular weight of 464.52 g/mol. Its IUPAC name is 3-(4-sulfobutyl)-1H-benzo[e]indol-3-ium-6,8-disulfonic acid.
| Compound Name | 3-(4-sulfobutyl)-1H-benzo[e]indol-3-ium-6,8-disulfonic acid |
|---|---|
| PubChem CID | 90748446 |
| Molecular Formula | C16H18NO9S3+ |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | 3-(4-sulfobutyl)-1H-benzo[e]indol-3-ium-6,8-disulfonic acid |
| SMILES | O=S(=O)(O)CCCC[N+]1=CCc2c1ccc1c(S(=O)(=O)O)cc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C16H17NO9S3/c18-27(19,20)8-2-1-6-17-7-5-12-14-9-11(28(21,22)23)10-16(29(24,25)26)13(14)3-4-15(12)17/h3-4,7,9-10H,1-2,5-6,8H2,(H2-,18,19,20,21,22,23,24,25,26)/p+1 |
| InChIKey | PMRIDGBAHSHEBO-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 166.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|