C7H10ClN — CID 90748717
(4Z)-2-chlorohepta-1,4-dien-3-imine (PubChem CID 90748717) has the molecular formula C7H10ClN and a molecular weight of 143.62 g/mol. Its IUPAC name is (4Z)-2-chlorohepta-1,4-dien-3-imine.
| Compound Name | (4Z)-2-chlorohepta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 90748717 |
| Molecular Formula | C7H10ClN |
| Molecular Weight | 143.62 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | (4Z)-2-chlorohepta-1,4-dien-3-imine |
| SMILES | [H]/N=C(/C=C\CC)C(=C)Cl |
| InChI | InChI=1S/C7H10ClN/c1-3-4-5-7(9)6(2)8/h4-5,9H,2-3H2,1H3/b5-4-,9-7- |
| InChIKey | XWEHEWZEPDOVDS-PHSHQRSZSA-N |
| XLogP | 2.72 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|