C16H20O — CID 90748729
1-(1H-inden-5-yl)-4,4-dimethylpentan-2-one (PubChem CID 90748729) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(1H-inden-5-yl)-4,4-dimethylpentan-2-one.
| Compound Name | 1-(1H-inden-5-yl)-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 90748729 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-(1H-inden-5-yl)-4,4-dimethylpentan-2-one |
| SMILES | CC(C)(C)CC(=O)Cc1ccc2c(c1)C=CC2 |
| InChI | InChI=1S/C16H20O/c1-16(2,3)11-15(17)10-12-7-8-13-5-4-6-14(13)9-12/h4,6-9H,5,10-11H2,1-3H3 |
| InChIKey | JIWOGBYYRYQEBB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |