C21H36O6 — CID 90748737
1,7-bis(2-ethenoxyethoxy)-4-[2-(2-ethenoxyethoxy)ethyl]hept-3-ene (PubChem CID 90748737) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 1,7-bis(2-ethenoxyethoxy)-4-[2-(2-ethenoxyethoxy)ethyl]hept-3-ene.
| Compound Name | 1,7-bis(2-ethenoxyethoxy)-4-[2-(2-ethenoxyethoxy)ethyl]hept-3-ene |
|---|---|
| PubChem CID | 90748737 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1,7-bis(2-ethenoxyethoxy)-4-[2-(2-ethenoxyethoxy)ethyl]hept-3-ene |
| SMILES | C=COCCOCCC=C(CCCOCCOC=C)CCOCCOC=C |
| InChI | InChI=1S/C21H36O6/c1-4-22-15-18-25-12-7-9-21(11-14-27-20-17-24-6-3)10-8-13-26-19-16-23-5-2/h4-6,9H,1-3,7-8,10-20H2 |
| InChIKey | LSVMQPGGIRFVQQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|