About N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide
N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide (PubChem CID 90748977) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide |
| PubChem CID | 90748977 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide |
| SMILES | CCCC1C(O)C(O)C(CNC(C)=O)N1C |
| InChI | InChI=1S/C11H22N2O3/c1-4-5-8-10(15)11(16)9(13(8)3)6-12-7(2)14/h8-11,15-16H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | FWEJIFPDOJMISO-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide?
The IUPAC name of N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide (CID 90748977) is N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide.
What is the SMILES notation for N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide?
The canonical SMILES for N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide is CCCC1C(O)C(O)C(CNC(C)=O)N1C.
What is the InChIKey of N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide?
The InChIKey is FWEJIFPDOJMISO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-4-5-8-10(15)11(16)9(13(8)3)6-12-7(2)14/h8-11,15-16H,4-6H2,1-3H3,(H,12,14).
What are the key properties of N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide?
N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide has a molecular weight of 230.31 g/mol, XLogP of -0.67, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dihydroxy-1-methyl-5-propylpyrrolidin-2-yl)methyl]acetamide is sourced from PubChem (CID 90748977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).