C16H30O6 — CID 90749107
methyl 2-[(4R,6S)-6-(2,2-dimethylpropyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2,2-dimethoxyacetate (PubChem CID 90749107) has the molecular formula C16H30O6 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl 2-[(4R,6S)-6-(2,2-dimethylpropyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2,2-dimethoxyacetate.
| Compound Name | methyl 2-[(4R,6S)-6-(2,2-dimethylpropyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2,2-dimethoxyacetate |
|---|---|
| PubChem CID | 90749107 |
| Molecular Formula | C16H30O6 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | methyl 2-[(4R,6S)-6-(2,2-dimethylpropyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2,2-dimethoxyacetate |
| SMILES | COC(=O)C(OC)(OC)[C@H]1C[C@H](CC(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C16H30O6/c1-14(2,3)10-11-9-12(22-15(4,5)21-11)16(19-7,20-8)13(17)18-6/h11-12H,9-10H2,1-8H3/t11-,12-/m1/s1 |
| InChIKey | QMJQWULFRCWYMK-VXGBXAGGSA-N |
| XLogP | 2.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|