About 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol
1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol (PubChem CID 90749412) has the molecular formula C18H17FN2O2
and a molecular weight of 312.34 g/mol. Its IUPAC name is 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol |
| PubChem CID | 90749412 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1CCCc1ccc(-c2ccccc2F)nc1 |
| InChI | InChI=1S/C18H17FN2O2/c19-15-6-2-1-5-14(15)16-8-7-13(12-20-16)4-3-11-21-17(22)9-10-18(21)23/h1-2,5-10,12,22-23H,3-4,11H2 |
| InChIKey | ODIRUSRMAGLGKW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol?
The IUPAC name of 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol (CID 90749412) is 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol.
What is the SMILES notation for 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol?
The canonical SMILES for 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol is Oc1ccc(O)n1CCCc1ccc(-c2ccccc2F)nc1.
What is the InChIKey of 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol?
The InChIKey is ODIRUSRMAGLGKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN2O2/c19-15-6-2-1-5-14(15)16-8-7-13(12-20-16)4-3-11-21-17(22)9-10-18(21)23/h1-2,5-10,12,22-23H,3-4,11H2.
What are the key properties of 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol?
1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol has a molecular weight of 312.34 g/mol, XLogP of 3.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[6-(2-fluorophenyl)-3-pyridinyl]propyl]pyrrole-2,5-diol is sourced from PubChem (CID 90749412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).