About ethane;N-methylacetamide;propan-1-amine
ethane;N-methylacetamide;propan-1-amine (PubChem CID 90749732) has the molecular formula C10H28N2O
and a molecular weight of 192.35 g/mol. Its IUPAC name is ethane;N-methylacetamide;propan-1-amine.
Molecular Properties
| Compound Name | ethane;N-methylacetamide;propan-1-amine |
| PubChem CID | 90749732 |
| Molecular Formula | C10H28N2O |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.22 |
| IUPAC Name | ethane;N-methylacetamide;propan-1-amine |
| SMILES | CC.CC.CCCN.CNC(C)=O |
| InChI | InChI=1S/C3H7NO.C3H9N.2C2H6/c1-3(5)4-2;1-2-3-4;2*1-2/h1-2H3,(H,4,5);2-4H2,1H3;2*1-2H3 |
| InChIKey | ACALXULZDGBMMX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-methylacetamide;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methylacetamide;propan-1-amine?
The IUPAC name of ethane;N-methylacetamide;propan-1-amine (CID 90749732) is ethane;N-methylacetamide;propan-1-amine.
What is the SMILES notation for ethane;N-methylacetamide;propan-1-amine?
The canonical SMILES for ethane;N-methylacetamide;propan-1-amine is CC.CC.CCCN.CNC(C)=O.
What is the InChIKey of ethane;N-methylacetamide;propan-1-amine?
The InChIKey is ACALXULZDGBMMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C3H9N.2C2H6/c1-3(5)4-2;1-2-3-4;2*1-2/h1-2H3,(H,4,5);2-4H2,1H3;2*1-2H3.
What are the key properties of ethane;N-methylacetamide;propan-1-amine?
ethane;N-methylacetamide;propan-1-amine has a molecular weight of 192.35 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methylacetamide;propan-1-amine is sourced from PubChem (CID 90749732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).