About 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide
2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide (PubChem CID 90749748) has the molecular formula C9H9N3OS
and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide.
Molecular Properties
| Compound Name | 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide |
| PubChem CID | 90749748 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)NC(=S)NC2 |
| InChI | InChI=1S/C9H9N3OS/c10-8(13)5-1-2-6-4-11-9(14)12-7(6)3-5/h1-3H,4H2,(H2,10,13)(H2,11,12,14) |
| InChIKey | FCKHDSRFAPTNAO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide?
The IUPAC name of 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide (CID 90749748) is 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide.
What is the SMILES notation for 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide?
The canonical SMILES for 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide is NC(=O)c1ccc2c(c1)NC(=S)NC2.
What is the InChIKey of 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide?
The InChIKey is FCKHDSRFAPTNAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3OS/c10-8(13)5-1-2-6-4-11-9(14)12-7(6)3-5/h1-3H,4H2,(H2,10,13)(H2,11,12,14).
What are the key properties of 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide?
2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide has a molecular weight of 207.26 g/mol, XLogP of 0.59, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-3,4-dihydro-1H-quinazoline-7-carboxamide is sourced from PubChem (CID 90749748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).