C28H26ClFN6O2 — CID 90749834
3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-methylanilino]phenyl]phenol (PubChem CID 90749834) has the molecular formula C28H26ClFN6O2 and a molecular weight of 533.01 g/mol. Its IUPAC name is 3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-methylanilino]phenyl]phenol.
| Compound Name | 3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-methylanilino]phenyl]phenol |
|---|---|
| PubChem CID | 90749834 |
| Molecular Formula | C28H26ClFN6O2 |
| Molecular Weight | 533.01 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-methylanilino]phenyl]phenol |
| SMILES | Cc1cc(Nc2cc(Cl)cc(-c3cccc(O)c3)c2)ccc1C/N=N/c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C28H26ClFN6O2/c1-18-11-23(33-24-13-21(12-22(29)15-24)19-3-2-4-25(37)14-19)6-5-20(18)16-32-35-28-31-17-26(30)27(34-28)36-7-9-38-10-8-36/h2-6,11-15,17,33,37H,7-10,16H2,1H3/b35-32+ |
| InChIKey | ZRHKNHNOXHJUFI-LVYIWIAJSA-N |
| XLogP | 6.81 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.01 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|