C23H20FN3O3 — CID 90750037
1-[3-[(4-fluorophenyl)methyl]-8,9-dihydroxy-7-methylpyrrolo[3,4-g]quinolin-5-yl]cyclopropane-1-carboxamide (PubChem CID 90750037) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is 1-[3-[(4-fluorophenyl)methyl]-8,9-dihydroxy-7-methylpyrrolo[3,4-g]quinolin-5-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-[3-[(4-fluorophenyl)methyl]-8,9-dihydroxy-7-methylpyrrolo[3,4-g]quinolin-5-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90750037 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[3-[(4-fluorophenyl)methyl]-8,9-dihydroxy-7-methylpyrrolo[3,4-g]quinolin-5-yl]cyclopropane-1-carboxamide |
| SMILES | Cn1cc2c(C3(C(N)=O)CC3)c3cc(Cc4ccc(F)cc4)cnc3c(O)c2c1O |
| InChI | InChI=1S/C23H20FN3O3/c1-27-11-16-17(21(27)29)20(28)19-15(18(16)23(6-7-23)22(25)30)9-13(10-26-19)8-12-2-4-14(24)5-3-12/h2-5,9-11,28-29H,6-8H2,1H3,(H2,25,30) |
| InChIKey | WBZKVMQSIGCRRF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|