C13H20N2 — CID 90750604
1-N'-(4-methylphenyl)cyclohexane-1,1-diamine (PubChem CID 90750604) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-N'-(4-methylphenyl)cyclohexane-1,1-diamine.
| Compound Name | 1-N'-(4-methylphenyl)cyclohexane-1,1-diamine |
|---|---|
| PubChem CID | 90750604 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-N'-(4-methylphenyl)cyclohexane-1,1-diamine |
| SMILES | Cc1ccc(NC2(N)CCCCC2)cc1 |
| InChI | InChI=1S/C13H20N2/c1-11-5-7-12(8-6-11)15-13(14)9-3-2-4-10-13/h5-8,15H,2-4,9-10,14H2,1H3 |
| InChIKey | ASXXSHXTUDWQQJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|