About (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one
(2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one (PubChem CID 90750706) has the molecular formula C9H16F3N3O
and a molecular weight of 239.24 g/mol. Its IUPAC name is (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one |
| PubChem CID | 90750706 |
| Molecular Formula | C9H16F3N3O |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one |
| SMILES | CN(C)[C@H](C(=O)N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O/c1-14(2)7(9(10,11)12)8(16)15-5-3-13-4-6-15/h7,13H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | RFZCBOQMXHILMS-SSDOTTSWSA-N |
| XLogP | -0.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one?
The IUPAC name of (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one (CID 90750706) is (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one.
What is the SMILES notation for (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one?
The canonical SMILES for (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one is CN(C)[C@H](C(=O)N1CCNCC1)C(F)(F)F.
What is the InChIKey of (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one?
The InChIKey is RFZCBOQMXHILMS-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H16F3N3O/c1-14(2)7(9(10,11)12)8(16)15-5-3-13-4-6-15/h7,13H,3-6H2,1-2H3/t7-/m1/s1.
What are the key properties of (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one?
(2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one has a molecular weight of 239.24 g/mol, XLogP of -0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(dimethylamino)-3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one is sourced from PubChem (CID 90750706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).