C19H15F6NO — CID 90750938
1,1,1,3,3,3-hexafluoro-2-(2-phenyl-4,5-dihydro-3H-1-benzazepin-7-yl)propan-2-ol (PubChem CID 90750938) has the molecular formula C19H15F6NO and a molecular weight of 387.32 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2-phenyl-4,5-dihydro-3H-1-benzazepin-7-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2-phenyl-4,5-dihydro-3H-1-benzazepin-7-yl)propan-2-ol |
|---|---|
| PubChem CID | 90750938 |
| Molecular Formula | C19H15F6NO |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2-phenyl-4,5-dihydro-3H-1-benzazepin-7-yl)propan-2-ol |
| SMILES | OC(c1ccc2c(c1)CCCC(c1ccccc1)=N2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H15F6NO/c20-18(21,22)17(27,19(23,24)25)14-9-10-16-13(11-14)7-4-8-15(26-16)12-5-2-1-3-6-12/h1-3,5-6,9-11,27H,4,7-8H2 |
| InChIKey | JEIQTKBQRFCBFU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |