About 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine
7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine (PubChem CID 90750973) has the molecular formula C16H13N3
and a molecular weight of 247.30 g/mol. Its IUPAC name is 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine |
| PubChem CID | 90750973 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine |
| SMILES | C(C=Cc1ccccn1)=Cc1ccn2ccnc2c1 |
| InChI | InChI=1S/C16H13N3/c1(2-6-15-7-3-4-9-17-15)5-14-8-11-19-12-10-18-16(19)13-14/h1-13H |
| InChIKey | BQNVJDWSNJGASX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine?
The IUPAC name of 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine (CID 90750973) is 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine?
The canonical SMILES for 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine is C(C=Cc1ccccn1)=Cc1ccn2ccnc2c1.
What is the InChIKey of 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine?
The InChIKey is BQNVJDWSNJGASX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3/c1(2-6-15-7-3-4-9-17-15)5-14-8-11-19-12-10-18-16(19)13-14/h1-13H.
What are the key properties of 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine?
7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine has a molecular weight of 247.30 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-pyridin-2-ylbuta-1,3-dienyl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 90750973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).