C13H9F17N2O2P+ — CID 90751147
2-[bis(1,1,2,2,2-pentafluoroethyl)phosphoryloxy]-1-(3,3,4,4,5,5,5-heptafluoropentyl)-3-methylimidazol-3-ium (PubChem CID 90751147) has the molecular formula C13H9F17N2O2P+ and a molecular weight of 579.17 g/mol. Its IUPAC name is 2-[bis(1,1,2,2,2-pentafluoroethyl)phosphoryloxy]-1-(3,3,4,4,5,5,5-heptafluoropentyl)-3-methylimidazol-3-ium.
| Compound Name | 2-[bis(1,1,2,2,2-pentafluoroethyl)phosphoryloxy]-1-(3,3,4,4,5,5,5-heptafluoropentyl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 90751147 |
| Molecular Formula | C13H9F17N2O2P+ |
| Molecular Weight | 579.17 g/mol |
| Exact Mass | 579.01 |
| IUPAC Name | 2-[bis(1,1,2,2,2-pentafluoroethyl)phosphoryloxy]-1-(3,3,4,4,5,5,5-heptafluoropentyl)-3-methylimidazol-3-ium |
| SMILES | C[n+]1ccn(CCC(F)(F)C(F)(F)C(F)(F)F)c1OP(=O)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F17N2O2P/c1-31-4-5-32(3-2-7(14,15)8(16,17)9(18,19)20)6(31)34-35(33,12(27,28)10(21,22)23)13(29,30)11(24,25)26/h4-5H,2-3H2,1H3/q+1 |
| InChIKey | IAEVHMYQLQLQDN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.17 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|