C26H41N5O5S2 — CID 90751449
N-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]butyl]-4-[(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)methyl]cyclohexane-1-carboxamide (PubChem CID 90751449) has the molecular formula C26H41N5O5S2 and a molecular weight of 567.78 g/mol. Its IUPAC name is N-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]butyl]-4-[(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]butyl]-4-[(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 90751449 |
| Molecular Formula | C26H41N5O5S2 |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | N-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]butyl]-4-[(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)methyl]cyclohexane-1-carboxamide |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)NCCCCNC(=O)C1CCC(Cn2c(O)cc(S)c2O)CC1 |
| InChI | InChI=1S/C26H41N5O5S2/c32-21(6-2-1-5-20-23-18(15-38-20)29-26(36)30-23)27-11-3-4-12-28-24(34)17-9-7-16(8-10-17)14-31-22(33)13-19(37)25(31)35/h13,16-18,20,23,33,35,37H,1-12,14-15H2,(H,27,32)(H,28,34)(H2,29,30,36)/t16?,17?,18-,20-,23-/m0/s1 |
| InChIKey | FPOVJYVWUJXVSZ-XYCOJPAGSA-N |
| XLogP | 2.73 |
| TPSA | 144.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|