C23H39N — CID 90751454
1-[2-[[4-(2,5-dimethylhepta-2,4-dienyl)cycloheptyl]methyl]cyclopropyl]propan-1-imine (PubChem CID 90751454) has the molecular formula C23H39N and a molecular weight of 329.57 g/mol. Its IUPAC name is 1-[2-[[4-(2,5-dimethylhepta-2,4-dienyl)cycloheptyl]methyl]cyclopropyl]propan-1-imine.
| Compound Name | 1-[2-[[4-(2,5-dimethylhepta-2,4-dienyl)cycloheptyl]methyl]cyclopropyl]propan-1-imine |
|---|---|
| PubChem CID | 90751454 |
| Molecular Formula | C23H39N |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.31 |
| IUPAC Name | 1-[2-[[4-(2,5-dimethylhepta-2,4-dienyl)cycloheptyl]methyl]cyclopropyl]propan-1-imine |
| SMILES | [H]/N=C(\CC)C1CC1CC1CCCC(CC(C)=CC=C(C)CC)CC1 |
| InChI | InChI=1S/C23H39N/c1-5-17(3)10-11-18(4)14-19-8-7-9-20(13-12-19)15-21-16-22(21)23(24)6-2/h10-11,19-22,24H,5-9,12-16H2,1-4H3/b17-10?,18-11?,24-23+ |
| InChIKey | PEDKDJFRRNDEER-HRXOBCANSA-N |
| XLogP | 7.33 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|