About cyclooctene-1,2,3-tricarbonitrile
cyclooctene-1,2,3-tricarbonitrile (PubChem CID 90751459) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is cyclooctene-1,2,3-tricarbonitrile.
Molecular Properties
| Compound Name | cyclooctene-1,2,3-tricarbonitrile |
| PubChem CID | 90751459 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | cyclooctene-1,2,3-tricarbonitrile |
| SMILES | N#CC1=C(C#N)C(C#N)CCCCC1 |
| InChI | InChI=1S/C11H11N3/c12-6-9-4-2-1-3-5-10(7-13)11(9)8-14/h9H,1-5H2 |
| InChIKey | VKUDMXSLYFCGCV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclooctene-1,2,3-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooctene-1,2,3-tricarbonitrile?
The IUPAC name of cyclooctene-1,2,3-tricarbonitrile (CID 90751459) is cyclooctene-1,2,3-tricarbonitrile.
What is the SMILES notation for cyclooctene-1,2,3-tricarbonitrile?
The canonical SMILES for cyclooctene-1,2,3-tricarbonitrile is N#CC1=C(C#N)C(C#N)CCCCC1.
What is the InChIKey of cyclooctene-1,2,3-tricarbonitrile?
The InChIKey is VKUDMXSLYFCGCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c12-6-9-4-2-1-3-5-10(7-13)11(9)8-14/h9H,1-5H2.
What are the key properties of cyclooctene-1,2,3-tricarbonitrile?
cyclooctene-1,2,3-tricarbonitrile has a molecular weight of 185.23 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooctene-1,2,3-tricarbonitrile is sourced from PubChem (CID 90751459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).