C18H19N3O4 — CID 9075161
methyl N-[(Z)-1-[4-(2-anilino-2-oxoethoxy)phenyl]ethylideneamino]carbamate (PubChem CID 9075161) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is methyl N-[(Z)-1-[4-(2-anilino-2-oxoethoxy)phenyl]ethylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-1-[4-(2-anilino-2-oxoethoxy)phenyl]ethylideneamino]carbamate |
|---|---|
| PubChem CID | 9075161 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | methyl N-[(Z)-1-[4-(2-anilino-2-oxoethoxy)phenyl]ethylideneamino]carbamate |
| SMILES | COC(=O)N/N=C(/C)c1ccc(OCC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N3O4/c1-13(20-21-18(23)24-2)14-8-10-16(11-9-14)25-12-17(22)19-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,19,22)(H,21,23)/b20-13- |
| InChIKey | OWUANMMNMVJZET-MOSHPQCFSA-N |
| XLogP | 2.78 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|