C15H24F4N2O6S — CID 90751808
N-hydroxy-N-[4-(2,2,3,3-tetrafluoropropoxymethyl)piperidin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 90751808) has the molecular formula C15H24F4N2O6S and a molecular weight of 436.42 g/mol. Its IUPAC name is N-hydroxy-N-[4-(2,2,3,3-tetrafluoropropoxymethyl)piperidin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-N-[4-(2,2,3,3-tetrafluoropropoxymethyl)piperidin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 90751808 |
| Molecular Formula | C15H24F4N2O6S |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-hydroxy-N-[4-(2,2,3,3-tetrafluoropropoxymethyl)piperidin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(C1CCOCC1)N(O)S(=O)(=O)N1CCC(COCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C15H24F4N2O6S/c16-14(17)15(18,19)10-27-9-11-1-5-20(6-2-11)28(24,25)21(23)13(22)12-3-7-26-8-4-12/h11-12,14,23H,1-10H2 |
| InChIKey | RRAUCTWQZABPRJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|