C20H13ClF3N3O3 — CID 90752194
(5R)-1'-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 90752194) has the molecular formula C20H13ClF3N3O3 and a molecular weight of 435.79 g/mol. Its IUPAC name is (5R)-1'-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | (5R)-1'-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 90752194 |
| Molecular Formula | C20H13ClF3N3O3 |
| Molecular Weight | 435.79 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | (5R)-1'-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | O=C1NC(=O)[C@@]2(N1)C(=O)N(CC=Cc1ccc(Cl)c(C(F)(F)F)c1)c1ccccc12 |
| InChI | InChI=1S/C20H13ClF3N3O3/c21-14-8-7-11(10-13(14)20(22,23)24)4-3-9-27-15-6-2-1-5-12(15)19(17(27)29)16(28)25-18(30)26-19/h1-8,10H,9H2,(H2,25,26,28,30)/t19-/m1/s1 |
| InChIKey | DWYITMMUPDAEMN-LJQANCHMSA-N |
| XLogP | 3.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.79 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|