C49H46N8O6 — CID 90752209
4-[3-[4-(3-aminopropylcarbamoyl)phenyl]indazol-1-yl]benzoic acid;4-[3-[4-[3-(methylamino)propylcarbamoyl]phenyl]indazol-1-yl]benzoic acid (PubChem CID 90752209) has the molecular formula C49H46N8O6 and a molecular weight of 842.96 g/mol. Its IUPAC name is 4-[3-[4-(3-aminopropylcarbamoyl)phenyl]indazol-1-yl]benzoic acid;4-[3-[4-[3-(methylamino)propylcarbamoyl]phenyl]indazol-1-yl]benzoic acid.
| Compound Name | 4-[3-[4-(3-aminopropylcarbamoyl)phenyl]indazol-1-yl]benzoic acid;4-[3-[4-[3-(methylamino)propylcarbamoyl]phenyl]indazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 90752209 |
| Molecular Formula | C49H46N8O6 |
| Molecular Weight | 842.96 g/mol |
| Exact Mass | 842.35 |
| IUPAC Name | 4-[3-[4-(3-aminopropylcarbamoyl)phenyl]indazol-1-yl]benzoic acid;4-[3-[4-[3-(methylamino)propylcarbamoyl]phenyl]indazol-1-yl]benzoic acid |
| SMILES | CNCCCNC(=O)c1ccc(-c2nn(-c3ccc(C(=O)O)cc3)c3ccccc23)cc1.NCCCNC(=O)c1ccc(-c2nn(-c3ccc(C(=O)O)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H24N4O3.C24H22N4O3/c1-26-15-4-16-27-24(30)18-9-7-17(8-10-18)23-21-5-2-3-6-22(21)29(28-23)20-13-11-19(12-14-20)25(31)32;25-14-3-15-26-23(29)17-8-6-16(7-9-17)22-20-4-1-2-5-21(20)28(27-22)19-12-10-18(11-13-19)24(30)31/h2-3,5-14,26H,4,15-16H2,1H3,(H,27,30)(H,31,32);1-2,4-13H,3,14-15,25H2,(H,26,29)(H,30,31) |
| InChIKey | DVSOAVKODLSZOA-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 206.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.96 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|