C23H34O5 — CID 90753550
2-[(8R,9S,10R,13S,14S,17R)-17-acetyl-3,17-dihydroxy-10,13-dimethyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthren-3-yl]acetic acid (PubChem CID 90753550) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,14S,17R)-17-acetyl-3,17-dihydroxy-10,13-dimethyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthren-3-yl]acetic acid.
| Compound Name | 2-[(8R,9S,10R,13S,14S,17R)-17-acetyl-3,17-dihydroxy-10,13-dimethyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthren-3-yl]acetic acid |
|---|---|
| PubChem CID | 90753550 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-[(8R,9S,10R,13S,14S,17R)-17-acetyl-3,17-dihydroxy-10,13-dimethyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthren-3-yl]acetic acid |
| SMILES | CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4CC(O)(CC(=O)O)C=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H34O5/c1-14(24)23(28)9-7-18-16-5-4-15-12-22(27,13-19(25)26)11-10-20(15,2)17(16)6-8-21(18,23)3/h10-11,15-18,27-28H,4-9,12-13H2,1-3H3,(H,25,26)/t15?,16-,17+,18+,20+,21+,22?,23+/m1/s1 |
| InChIKey | YSQNLANOTXXVIG-XOOZRVMKSA-N |
| XLogP | 3.33 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|