C13H12N2O4 — CID 90753935
4-methyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaene-3,5,9,11-tetrol (PubChem CID 90753935) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 4-methyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaene-3,5,9,11-tetrol.
| Compound Name | 4-methyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaene-3,5,9,11-tetrol |
|---|---|
| PubChem CID | 90753935 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-methyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaene-3,5,9,11-tetrol |
| SMILES | Cn1c(O)c2c(c1O)C1C=CC2c2c(O)[nH]c(O)c21 |
| InChI | InChI=1S/C13H12N2O4/c1-15-12(18)8-4-2-3-5(9(8)13(15)19)7-6(4)10(16)14-11(7)17/h2-5,14,16-19H,1H3 |
| InChIKey | XZSBPFQQNUFAAE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|