About benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate
benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 90754040) has the molecular formula C26H20N6O2
and a molecular weight of 448.49 g/mol. Its IUPAC name is benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| PubChem CID | 90754040 |
| Molecular Formula | C26H20N6O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC1=Nc2nnnn2C(c2ccccc2-c2ccccc2C#N)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H20N6O2/c1-17-23(25(33)34-16-18-9-3-2-4-10-18)24(32-26(28-17)29-30-31-32)22-14-8-7-13-21(22)20-12-6-5-11-19(20)15-27/h2-14,23-24H,16H2,1H3 |
| InChIKey | QJVMBRGBABSXEJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 106.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate?
The IUPAC name of benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (CID 90754040) is benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
What is the SMILES notation for benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate?
The canonical SMILES for benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate is CC1=Nc2nnnn2C(c2ccccc2-c2ccccc2C#N)C1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate?
The InChIKey is QJVMBRGBABSXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N6O2/c1-17-23(25(33)34-16-18-9-3-2-4-10-18)24(32-26(28-17)29-30-31-32)22-14-8-7-13-21(22)20-12-6-5-11-19(20)15-27/h2-14,23-24H,16H2,1H3.
What are the key properties of benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate?
benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate has a molecular weight of 448.49 g/mol, XLogP of 4.27, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 7-[2-(2-cyanophenyl)phenyl]-5-methyl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate is sourced from PubChem (CID 90754040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).