C26H28N4O5 — CID 90754177
methyl N-[[5-[3-tert-butyl-5-(2,4-dioxo-1H-pyrimidin-3-yl)-2-methoxyphenyl]-2,3-dihydroinden-1-ylidene]amino]carbamate (PubChem CID 90754177) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is methyl N-[[5-[3-tert-butyl-5-(2,4-dioxo-1H-pyrimidin-3-yl)-2-methoxyphenyl]-2,3-dihydroinden-1-ylidene]amino]carbamate.
| Compound Name | methyl N-[[5-[3-tert-butyl-5-(2,4-dioxo-1H-pyrimidin-3-yl)-2-methoxyphenyl]-2,3-dihydroinden-1-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 90754177 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | methyl N-[[5-[3-tert-butyl-5-(2,4-dioxo-1H-pyrimidin-3-yl)-2-methoxyphenyl]-2,3-dihydroinden-1-ylidene]amino]carbamate |
| SMILES | COC(=O)NN=C1CCc2cc(-c3cc(-n4c(=O)cc[nH]c4=O)cc(C(C)(C)C)c3OC)ccc21 |
| InChI | InChI=1S/C26H28N4O5/c1-26(2,3)20-14-17(30-22(31)10-11-27-24(30)32)13-19(23(20)34-4)16-6-8-18-15(12-16)7-9-21(18)28-29-25(33)35-5/h6,8,10-14H,7,9H2,1-5H3,(H,27,32)(H,29,33) |
| InChIKey | BNDRWWYNRMPFQU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|