About methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate
methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate (PubChem CID 90754219) has the molecular formula C25H28N2O4
and a molecular weight of 420.51 g/mol. Its IUPAC name is methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate |
| PubChem CID | 90754219 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1(C)C=C(c2ccccc2C(=O)N2CCC(Cc3ccccc3)CC2)NO1 |
| InChI | InChI=1S/C25H28N2O4/c1-25(24(29)30-2)17-22(26-31-25)20-10-6-7-11-21(20)23(28)27-14-12-19(13-15-27)16-18-8-4-3-5-9-18/h3-11,17,19,26H,12-16H2,1-2H3 |
| InChIKey | WQKISGJYKVFLLJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate?
The IUPAC name of methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate (CID 90754219) is methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate?
The canonical SMILES for methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate is COC(=O)C1(C)C=C(c2ccccc2C(=O)N2CCC(Cc3ccccc3)CC2)NO1.
What is the InChIKey of methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate?
The InChIKey is WQKISGJYKVFLLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2O4/c1-25(24(29)30-2)17-22(26-31-25)20-10-6-7-11-21(20)23(28)27-14-12-19(13-15-27)16-18-8-4-3-5-9-18/h3-11,17,19,26H,12-16H2,1-2H3.
What are the key properties of methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate?
methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate has a molecular weight of 420.51 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-2H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 90754219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).