C26H33F3N2O5Si — CID 90754764
4-[(4R,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3-dihydroxy-4-[(2S)-2-hydroxypropyl]-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 90754764) has the molecular formula C26H33F3N2O5Si and a molecular weight of 538.64 g/mol. Its IUPAC name is 4-[(4R,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3-dihydroxy-4-[(2S)-2-hydroxypropyl]-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(4R,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3-dihydroxy-4-[(2S)-2-hydroxypropyl]-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 90754764 |
| Molecular Formula | C26H33F3N2O5Si |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 4-[(4R,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3-dihydroxy-4-[(2S)-2-hydroxypropyl]-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@H](O)C[C@]12O[C@](C)(C[C@@H]1O[Si](C)(C)C(C)(C)C)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C26H33F3N2O5Si/c1-14(32)11-25-18(35-37(6,7)23(2,3)4)12-24(5,36-25)19-20(25)22(34)31(21(19)33)16-9-8-15(13-30)17(10-16)26(27,28)29/h8-10,14,18,32-34H,11-12H2,1-7H3/t14-,18-,24+,25-/m0/s1 |
| InChIKey | UMCVBTGGEHYCTB-BYIYLFCRSA-N |
| XLogP | 5.78 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|