About N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide
N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide (PubChem CID 90754989) has the molecular formula C24H47N3
and a molecular weight of 377.66 g/mol. Its IUPAC name is N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide |
| PubChem CID | 90754989 |
| Molecular Formula | C24H47N3 |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 377.38 |
| IUPAC Name | N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide |
| SMILES | CCCCN(CC)/C(=N\C1CCCCC1)N1CCCC(CC(C)(C)CC)C1 |
| InChI | InChI=1S/C24H47N3/c1-6-9-17-26(8-3)23(25-22-15-11-10-12-16-22)27-18-13-14-21(20-27)19-24(4,5)7-2/h21-22H,6-20H2,1-5H3/b25-23+ |
| InChIKey | WGNZVMRHDQJNFR-WJTDDFOZSA-N |
| XLogP | 6.34 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide?
The IUPAC name of N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide (CID 90754989) is N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide.
What is the SMILES notation for N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide?
The canonical SMILES for N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide is CCCCN(CC)/C(=N\C1CCCCC1)N1CCCC(CC(C)(C)CC)C1.
What is the InChIKey of N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide?
The InChIKey is WGNZVMRHDQJNFR-WJTDDFOZSA-N. The full InChI is InChI=1S/C24H47N3/c1-6-9-17-26(8-3)23(25-22-15-11-10-12-16-22)27-18-13-14-21(20-27)19-24(4,5)7-2/h21-22H,6-20H2,1-5H3/b25-23+.
What are the key properties of N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide?
N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide has a molecular weight of 377.66 g/mol, XLogP of 6.34, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-cyclohexyl-3-(2,2-dimethylbutyl)-N-ethylpiperidine-1-carboximidamide is sourced from PubChem (CID 90754989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).