C16H22FN2O4+ — CID 90755404
6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-2-methoxy-2-methyl-3H-1,2-benzoxazol-2-ium-5-carbaldehyde (PubChem CID 90755404) has the molecular formula C16H22FN2O4+ and a molecular weight of 325.36 g/mol. Its IUPAC name is 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-2-methoxy-2-methyl-3H-1,2-benzoxazol-2-ium-5-carbaldehyde.
| Compound Name | 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-2-methoxy-2-methyl-3H-1,2-benzoxazol-2-ium-5-carbaldehyde |
|---|---|
| PubChem CID | 90755404 |
| Molecular Formula | C16H22FN2O4+ |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-2-methoxy-2-methyl-3H-1,2-benzoxazol-2-ium-5-carbaldehyde |
| SMILES | CO[N+]1(C)Cc2cc(C=O)c(N3C[C@@H](C)O[C@@H](C)C3)c(F)c2O1 |
| InChI | InChI=1S/C16H22FN2O4/c1-10-6-18(7-11(2)22-10)15-13(9-20)5-12-8-19(3,21-4)23-16(12)14(15)17/h5,9-11H,6-8H2,1-4H3/q+1/t10-,11+,19? |
| InChIKey | ORQRBULQZGTJKJ-PZTPGRSTSA-N |
| XLogP | 2.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|