C23H37NO2 — CID 90755537
1-methoxy-4-(1-methylcyclopentyl)benzene;N-[2-(1-methylcyclopentyl)ethyl]acetamide (PubChem CID 90755537) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is 1-methoxy-4-(1-methylcyclopentyl)benzene;N-[2-(1-methylcyclopentyl)ethyl]acetamide.
| Compound Name | 1-methoxy-4-(1-methylcyclopentyl)benzene;N-[2-(1-methylcyclopentyl)ethyl]acetamide |
|---|---|
| PubChem CID | 90755537 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 1-methoxy-4-(1-methylcyclopentyl)benzene;N-[2-(1-methylcyclopentyl)ethyl]acetamide |
| SMILES | CC(=O)NCCC1(C)CCCC1.COc1ccc(C2(C)CCCC2)cc1 |
| InChI | InChI=1S/C13H18O.C10H19NO/c1-13(9-3-4-10-13)11-5-7-12(14-2)8-6-11;1-9(12)11-8-7-10(2)5-3-4-6-10/h5-8H,3-4,9-10H2,1-2H3;3-8H2,1-2H3,(H,11,12) |
| InChIKey | CVGSVDVSBSFBNT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |