C14H10F3NO3 — CID 90755900
(4R,7S)-2-(2,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-diol (PubChem CID 90755900) has the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. Its IUPAC name is (4R,7S)-2-(2,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-diol.
| Compound Name | (4R,7S)-2-(2,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 90755900 |
| Molecular Formula | C14H10F3NO3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (4R,7S)-2-(2,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1-c1cc(F)c(F)cc1F)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C14H10F3NO3/c15-5-3-7(17)8(4-6(5)16)18-13(19)11-9-1-2-10(21-9)12(11)14(18)20/h3-4,9-10,19-20H,1-2H2/t9-,10+ |
| InChIKey | AXGKLVJCZKXRTP-AOOOYVTPSA-N |
| XLogP | 3.21 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|