About (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate
(2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate (PubChem CID 90756330) has the molecular formula C10H13NO6
and a molecular weight of 243.21 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate |
| PubChem CID | 90756330 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate |
| SMILES | CC(=O)OC(C)CC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C10H13NO6/c1-6(16-7(2)12)5-10(15)17-11-8(13)3-4-9(11)14/h3-4,6,13-14H,5H2,1-2H3 |
| InChIKey | SMAAVLGWNXNOTE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate (CID 90756330) is (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate is CC(=O)OC(C)CC(=O)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate?
The InChIKey is SMAAVLGWNXNOTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO6/c1-6(16-7(2)12)5-10(15)17-11-8(13)3-4-9(11)14/h3-4,6,13-14H,5H2,1-2H3.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate?
(2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate has a molecular weight of 243.21 g/mol, XLogP of 0.20, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 3-acetyloxybutanoate is sourced from PubChem (CID 90756330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).