C23H35NO3S — CID 90756584
(5R)-1-[2-(4-hydroxybutylsulfanyl)ethyl]-5-[(3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]pyrrolidin-2-one (PubChem CID 90756584) has the molecular formula C23H35NO3S and a molecular weight of 405.60 g/mol. Its IUPAC name is (5R)-1-[2-(4-hydroxybutylsulfanyl)ethyl]-5-[(3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]pyrrolidin-2-one.
| Compound Name | (5R)-1-[2-(4-hydroxybutylsulfanyl)ethyl]-5-[(3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 90756584 |
| Molecular Formula | C23H35NO3S |
| Molecular Weight | 405.60 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (5R)-1-[2-(4-hydroxybutylsulfanyl)ethyl]-5-[(3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]pyrrolidin-2-one |
| SMILES | CCCc1cccc(C[C@H](O)C=C[C@H]2CCC(=O)N2CCSCCCCO)c1 |
| InChI | InChI=1S/C23H35NO3S/c1-2-6-19-7-5-8-20(17-19)18-22(26)11-9-21-10-12-23(27)24(21)13-16-28-15-4-3-14-25/h5,7-9,11,17,21-22,25-26H,2-4,6,10,12-16,18H2,1H3/t21-,22+/m0/s1 |
| InChIKey | SCWMCIJXRLYVPK-FCHUYYIVSA-N |
| XLogP | 3.60 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|