C18H17FN2O2S — CID 90757858
4-[[2-(3-fluorophenyl)-5-methylpyrrol-1-yl]methyl]benzenesulfonamide (PubChem CID 90757858) has the molecular formula C18H17FN2O2S and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-[[2-(3-fluorophenyl)-5-methylpyrrol-1-yl]methyl]benzenesulfonamide.
| Compound Name | 4-[[2-(3-fluorophenyl)-5-methylpyrrol-1-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90757858 |
| Molecular Formula | C18H17FN2O2S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 4-[[2-(3-fluorophenyl)-5-methylpyrrol-1-yl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2cccc(F)c2)n1Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H17FN2O2S/c1-13-5-10-18(15-3-2-4-16(19)11-15)21(13)12-14-6-8-17(9-7-14)24(20,22)23/h2-11H,12H2,1H3,(H2,20,22,23) |
| InChIKey | FKOLPJGVYNDATC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|