C29H50O6Si — CID 90757975
methyl 4-[(2R,3S)-2-[3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-triethylsilyloxyoxolan-3-yl]but-2-enoate (PubChem CID 90757975) has the molecular formula C29H50O6Si and a molecular weight of 522.80 g/mol. Its IUPAC name is methyl 4-[(2R,3S)-2-[3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-triethylsilyloxyoxolan-3-yl]but-2-enoate.
| Compound Name | methyl 4-[(2R,3S)-2-[3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-triethylsilyloxyoxolan-3-yl]but-2-enoate |
|---|---|
| PubChem CID | 90757975 |
| Molecular Formula | C29H50O6Si |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | methyl 4-[(2R,3S)-2-[3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-triethylsilyloxyoxolan-3-yl]but-2-enoate |
| SMILES | CC[Si](CC)(CC)OC1CO[C@H](C=CC(OC2CCCCO2)C2CCCCC2)[C@@H]1CC=CC(=O)OC |
| InChI | InChI=1S/C29H50O6Si/c1-5-36(6-2,7-3)35-27-22-33-26(24(27)16-13-17-28(30)31-4)20-19-25(23-14-9-8-10-15-23)34-29-18-11-12-21-32-29/h13,17,19-20,23-27,29H,5-12,14-16,18,21-22H2,1-4H3/t24-,25?,26+,27?,29?/m0/s1 |
| InChIKey | HPKRQUBRUHANOI-LZBXQSRESA-N |
| XLogP | 6.56 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|