C23H25FN4O7S3 — CID 90758352
N-[[3-[1-[(4-fluoro-3-methoxyphenyl)methyl]-2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide (PubChem CID 90758352) has the molecular formula C23H25FN4O7S3 and a molecular weight of 584.67 g/mol. Its IUPAC name is N-[[3-[1-[(4-fluoro-3-methoxyphenyl)methyl]-2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[1-[(4-fluoro-3-methoxyphenyl)methyl]-2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 90758352 |
| Molecular Formula | C23H25FN4O7S3 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | N-[[3-[1-[(4-fluoro-3-methoxyphenyl)methyl]-2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
| SMILES | COc1cc(CN2C(=O)C(C3=NS(=O)(=O)c4c(CNS(C)(=O)=O)csc4N3)C(=O)C3CCCC32)ccc1F |
| InChI | InChI=1S/C23H25FN4O7S3/c1-35-17-8-12(6-7-15(17)24)10-28-16-5-3-4-14(16)19(29)18(23(28)30)21-26-22-20(38(33,34)27-21)13(11-36-22)9-25-37(2,31)32/h6-8,11,14,16,18,25H,3-5,9-10H2,1-2H3,(H,26,27) |
| InChIKey | AOUSTRUXSCKWQR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 151.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|