C17H18N2O — CID 90758501
2-cyclohexa-1,5-dien-1-yl-5-(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-1,3,4-oxadiazole (PubChem CID 90758501) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-5-(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-1,3,4-oxadiazole.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-5-(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90758501 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-5-(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-1,3,4-oxadiazole |
| SMILES | CC1(C)C=CC=CC(c2nnc(C3=CCCC=C3)o2)=C1 |
| InChI | InChI=1S/C17H18N2O/c1-17(2)11-7-6-10-14(12-17)16-19-18-15(20-16)13-8-4-3-5-9-13/h4,6-12H,3,5H2,1-2H3 |
| InChIKey | SWUBTLSPLROARG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |