C33H41FN4O3 — CID 90758694
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methylamino]butyl]-4-(4-ethylpiperazin-1-yl)isoindol-1-ol (PubChem CID 90758694) has the molecular formula C33H41FN4O3 and a molecular weight of 560.71 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methylamino]butyl]-4-(4-ethylpiperazin-1-yl)isoindol-1-ol.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methylamino]butyl]-4-(4-ethylpiperazin-1-yl)isoindol-1-ol |
|---|---|
| PubChem CID | 90758694 |
| Molecular Formula | C33H41FN4O3 |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methylamino]butyl]-4-(4-ethylpiperazin-1-yl)isoindol-1-ol |
| SMILES | CCN1CCN(c2cccc3c(O)n([C@H](CCCNCc4ccc(F)cc4)c4ccc(OC)c(OC)c4)cc23)CC1 |
| InChI | InChI=1S/C33H41FN4O3/c1-4-36-17-19-37(20-18-36)30-8-5-7-27-28(30)23-38(33(27)39)29(25-12-15-31(40-2)32(21-25)41-3)9-6-16-35-22-24-10-13-26(34)14-11-24/h5,7-8,10-15,21,23,29,35,39H,4,6,9,16-20,22H2,1-3H3/t29-/m1/s1 |
| InChIKey | RJVLJNBOOKJEGE-GDLZYMKVSA-N |
| XLogP | 5.80 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|