C8H12O3 — CID 90759486
2,3,4,5,6,8-hexahydropyrano[3,4-b]pyran-4-ol (PubChem CID 90759486) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2,3,4,5,6,8-hexahydropyrano[3,4-b]pyran-4-ol.
| Compound Name | 2,3,4,5,6,8-hexahydropyrano[3,4-b]pyran-4-ol |
|---|---|
| PubChem CID | 90759486 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2,3,4,5,6,8-hexahydropyrano[3,4-b]pyran-4-ol |
| SMILES | OC1CCOC2=C1CCOC2 |
| InChI | InChI=1S/C8H12O3/c9-7-2-4-11-8-5-10-3-1-6(7)8/h7,9H,1-5H2 |
| InChIKey | FBFMHCYSFXQUCG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |