C23H37N5O2 — CID 90759554
N-[(1S)-cyclohept-3-en-1-yl]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide (PubChem CID 90759554) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-[(1S)-cyclohept-3-en-1-yl]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide.
| Compound Name | N-[(1S)-cyclohept-3-en-1-yl]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide |
|---|---|
| PubChem CID | 90759554 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | N-[(1S)-cyclohept-3-en-1-yl]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide |
| SMILES | CNC(=O)[C@@H](N(C(=O)c1ncn2c1CN(C)CCC2)[C@@H]1CC=CCCC1)C(C)(C)C |
| InChI | InChI=1S/C23H37N5O2/c1-23(2,3)20(21(29)24-4)28(17-11-8-6-7-9-12-17)22(30)19-18-15-26(5)13-10-14-27(18)16-25-19/h6,8,16-17,20H,7,9-15H2,1-5H3,(H,24,29)/t17-,20-/m1/s1 |
| InChIKey | HSBSVZNWMPTHFI-YLJYHZDGSA-N |
| XLogP | 2.82 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|